import gradio as gr from transformers import pipeline import torch import os hf_token = os.environ.get("HF_TOKEN") # Load model TxGemma-2B print("Load model TxGemma...") pipe = pipeline( "text-generation", model="google/txgemma-2b-predict", device="cpu", torch_dtype=torch.float32, token=hf_token ) def process_prompt(user_input): """ Processing """ try: # Generate response outputs = pipe( user_input, max_new_tokens=256, do_sample=True, temperature=0.7 ) response = outputs[0]["generated_text"] return response except Exception as e: return f"Errore durante l'elaborazione: {str(e)}" # Create Interface demo = gr.Interface( fn=process_prompt, inputs=gr.Textbox( label="Inserisci il prompt per TxGemma", placeholder="Esempio: CCO (molecola di etanolo)", lines=5 ), outputs=gr.Textbox( label="Risposta di TxGemma", lines=10 ), title="Demo TxGemma - Analisi Molecolare", description="Inserisci un prompt (es. stringa SMILES di una molecola) e TxGemma fornirà previsioni sulle proprietà terapeutiche.", examples=[ ["CC(C)Cc1ccc(cc1)C(C)C(O)=O"], # Ibuprofene ["CN1C=NC2=C1C(=O)N(C(=O)N2C)C"], # Caffeina ], theme="soft" ) # Launch app if __name__ == "__main__": demo.launch() # After load of the model model_info = f""" **Model load:** {pipe.model.config._name_or_path} **Type:** {pipe.model.config.model_type} **Parameters:** {pipe.model.num_parameters() / 1e9:.2f}B **Spec:** Therapeutic Development (TDC) """